Difference between revisions of "PWY-6041"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * common-name: ** 6,7-dehydrobaicalein * smiles: ** c1(c=cc(=cc=1)c2(=c...")
(Created page with "Category:pathway == Pathway PWY-6041 == * taxonomic-range: ** tax-2 * common-name: ** 4-sulfocatechol degradation == Reaction(s) found == * RXN-9733 == Reaction(s) not...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
+
== Pathway PWY-6041 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 6,7-dehydrobaicalein
+
** 4-sulfocatechol degradation
* smiles:
+
== Reaction(s) found ==
** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
+
* [[RXN-9733]]
* inchi-key:
+
== Reaction(s) not found ==
** lsqwciyrgvwpfx-uhfffaoysa-n
+
* [NoneMALEYLACETATE-REDUCTASE-RXN MALEYLACETATE-REDUCTASE-RXN]
* molecular-weight:
+
* [NoneRXN-9731 RXN-9731]
** 268.225
+
* [NoneRXN-9732 RXN-9732]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=4-sulfocatechol degradation}}
* [[RXN-14240]]
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.25}}
{{#set: common-name=6,7-dehydrobaicalein}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=lsqwciyrgvwpfx-uhfffaoysa-n}}
 
{{#set: molecular-weight=268.225}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-6041

  • taxonomic-range:
    • tax-2
  • common-name:
    • 4-sulfocatechol degradation

Reaction(s) found

Reaction(s) not found

  • [NoneMALEYLACETATE-REDUCTASE-RXN MALEYLACETATE-REDUCTASE-RXN]
  • [NoneRXN-9731 RXN-9731]
  • [NoneRXN-9732 RXN-9732]