Difference between revisions of "SUCROSEUTIL2-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] == * common-name: ** 3r-hydroxy-(11z)-eicos-11-enoyl-coa * smiles: ** cccc...")
(Created page with "Category:pathway == Pathway PWY-7003 == * taxonomic-range: ** tax-2 * common-name: ** glycerol degradation to butanol == Reaction(s) found == * 2PGADEHYDRAT-RXN * 3P...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] ==
+
== Pathway PWY-7003 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 3r-hydroxy-(11z)-eicos-11-enoyl-coa
+
** glycerol degradation to butanol
* smiles:
+
== Reaction(s) found ==
** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[2PGADEHYDRAT-RXN]]
* inchi-key:
+
* [[3PGAREARR-RXN]]
** preomqknjxwclz-zhlmiuqrsa-j
+
* [[GAPOXNPHOSPHN-RXN]]
* molecular-weight:
+
* [[PEPDEPHOS-RXN]]
** 1072.006
+
* [[PHOSGLYPHOS-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[TRIOSEPISOMERIZATION-RXN]]
* [[RXN-14485]]
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
All reactions of this pathways are in present
* [[RXN-14484]]
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=glycerol degradation to butanol}}
{{#set: common-name=3r-hydroxy-(11z)-eicos-11-enoyl-coa}}
+
{{#set: nb reaction found=6}}
{{#set: inchi-key=inchikey=preomqknjxwclz-zhlmiuqrsa-j}}
+
{{#set: completion rate=1.0}}
{{#set: molecular-weight=1072.006}}
+
{{#set: nb total reaction=6}}

Revision as of 20:17, 18 December 2020

Pathway PWY-7003

  • taxonomic-range:
    • tax-2
  • common-name:
    • glycerol degradation to butanol

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present