Difference between revisions of "SJ01558"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12173 CPD-12173] == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * smiles: ** cc(c(=o)sc...")
(Created page with "Category:gene == Gene SJ07231 == * transcription-direction: ** negative * right-end-position: ** 1137985 * left-end-position: ** 1131578 * centisome-position: ** 77.448265...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12173 CPD-12173] ==
+
== Gene SJ07231 ==
−
* common-name:
+
* transcription-direction:
−
** (s)-3-hydroxy-isobutanoyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
+
** 1137985
−
* inchi-key:
+
* left-end-position:
−
** wweogfzefhpuam-uqcjfraesa-j
+
** 1131578
−
* molecular-weight:
+
* centisome-position:
−
** 849.593
+
** 77.448265   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
+
* [[S.japonica_sterols_curated]]
−
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=(s)-3-hydroxy-isobutanoyl-coa}}
+
** Category: [[orthology]]
−
{{#set: inchi-key=inchikey=wweogfzefhpuam-uqcjfraesa-j}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: molecular-weight=849.593}}
+
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=1137985}}
 +
{{#set: left-end-position=1131578}}
 +
{{#set: centisome-position=77.448265    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ07231

  • transcription-direction:
    • negative
  • right-end-position:
    • 1137985
  • left-end-position:
    • 1131578
  • centisome-position:
    • 77.448265

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ01558&oldid=40850"