Difference between revisions of "SJ14527"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-45-DIHYDROXYBENZOATE 3-HEXAPRENYL-45-DIHYDROXYBENZOATE] == * common-name: ** 3,4-d...")
(Created page with "Category:gene == Gene SJ21474 == * transcription-direction: ** negative * right-end-position: ** 174516 * left-end-position: ** 169082 * centisome-position: ** 88.11356...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-45-DIHYDROXYBENZOATE 3-HEXAPRENYL-45-DIHYDROXYBENZOATE] ==
+
== Gene SJ21474 ==
* common-name:
+
* transcription-direction:
** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
+
** negative
* smiles:
+
* right-end-position:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
+
** 174516
* inchi-key:
+
* left-end-position:
** vepicjbqcouqpi-irvxxiiisa-m
+
** 169082
* molecular-weight:
+
* centisome-position:
** 561.823
+
** 88.11356   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.1.1.114-RXN]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[DISULFOXRED-RXN]]
{{#set: common-name=3,4-dihydroxy-5-all-trans-hexaprenylbenzoate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=vepicjbqcouqpi-irvxxiiisa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=561.823}}
+
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY66-374]]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=174516}}
 +
{{#set: left-end-position=169082}}
 +
{{#set: centisome-position=88.11356    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ21474

  • transcription-direction:
    • negative
  • right-end-position:
    • 174516
  • left-end-position:
    • 169082
  • centisome-position:
    • 88.11356

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY66-374
    • 2 reactions found over 5 reactions in the full pathway