Difference between revisions of "SJ19904"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-692 CPD-692] == * common-name: ** (+)-cis-abscisic aldehyde * smiles: ** cc(=cc=o)c=cc1(c(c...")
(Created page with "Category:gene == Gene SJ05044 == * transcription-direction: ** negative * right-end-position: ** 14838 * left-end-position: ** 11474 * centisome-position: ** 11.771585...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-692 CPD-692] ==
+
== Gene SJ05044 ==
* common-name:
+
* transcription-direction:
** (+)-cis-abscisic aldehyde
+
** negative
* smiles:
+
* right-end-position:
** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
+
** 14838
* inchi-key:
+
* left-end-position:
** rikwdzwvhuiuam-kicrzjjpsa-n
+
** 11474
* molecular-weight:
+
* centisome-position:
** 248.321
+
** 11.771585   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[1.2.3.14-RXN]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[1.1.1.288-RXN]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(+)-cis-abscisic aldehyde}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=rikwdzwvhuiuam-kicrzjjpsa-n}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=248.321}}
+
{{#set: right-end-position=14838}}
 +
{{#set: left-end-position=11474}}
 +
{{#set: centisome-position=11.771585    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ05044

  • transcription-direction:
    • negative
  • right-end-position:
    • 14838
  • left-end-position:
    • 11474
  • centisome-position:
    • 11.771585

Organism(s) associated with this gene

Reaction(s) associated