Difference between revisions of "SJ06735"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9406 CPD-9406] == * common-name: ** (2s)-ethylmalonyl-coa * smiles: ** ccc(c(sccnc(=o)ccnc(...")
(Created page with "Category:gene == Gene SJ06233 == * transcription-direction: ** negative * right-end-position: ** 78158 * left-end-position: ** 73793 * centisome-position: ** 89.028435...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9406 CPD-9406] ==
+
== Gene SJ06233 ==
−
* common-name:
+
* transcription-direction:
−
** (2s)-ethylmalonyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
+
** 78158
−
* inchi-key:
+
* left-end-position:
−
** vugzqvcbbbezqe-uqcjfraesa-i
+
** 73793
−
* molecular-weight:
+
* centisome-position:
−
** 876.595
+
** 89.028435   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-13029]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-13029]]
+
* [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=(2s)-ethylmalonyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}}
+
* [[TAU-PROTEIN-KINASE-RXN]]
−
{{#set: molecular-weight=876.595}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=78158}}
 +
{{#set: left-end-position=73793}}
 +
{{#set: centisome-position=89.028435    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}

Revision as of 20:21, 18 December 2020

Gene SJ06233

  • transcription-direction:
    • negative
  • right-end-position:
    • 78158
  • left-end-position:
    • 73793
  • centisome-position:
    • 89.028435

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06735&oldid=41717"