Difference between revisions of "SJ10166"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c...")
(Created page with "Category:gene == Gene SJ22323 == * transcription-direction: ** negative * right-end-position: ** 131542 * left-end-position: ** 130088 * centisome-position: ** 73.091354...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] ==
+
== Gene SJ22323 ==
* common-name:
+
* transcription-direction:
** 5',5'''-diadenosine tetraphosphate
+
** negative
* smiles:
+
* right-end-position:
** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
+
** 131542
* inchi-key:
+
* left-end-position:
** yoahknvsncmzgq-xpwfqurosa-j
+
** 130088
* molecular-weight:
+
* centisome-position:
** 832.36
+
** 73.091354   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[3.6.1.41-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=5',5'''-diadenosine tetraphosphate}}
+
{{#set: transcription-direction=negative}}
{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
+
{{#set: right-end-position=131542}}
{{#set: molecular-weight=832.36}}
+
{{#set: left-end-position=130088}}
 +
{{#set: centisome-position=73.091354    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ22323

  • transcription-direction:
    • negative
  • right-end-position:
    • 131542
  • left-end-position:
    • 130088
  • centisome-position:
    • 73.091354

Organism(s) associated with this gene

Reaction(s) associated