Difference between revisions of "SJ04764"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMIDINE THYMIDINE] == * common-name: ** thymidine * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c...")
(Created page with "Category:gene == Gene SJ21060 == * transcription-direction: ** negative * right-end-position: ** 124492 * left-end-position: ** 109722 * centisome-position: ** 55.243282...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMIDINE THYMIDINE] ==
+
== Gene SJ21060 ==
* common-name:
+
* transcription-direction:
** thymidine
+
** negative
* smiles:
+
* right-end-position:
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
+
** 124492
* inchi-key:
+
* left-end-position:
** iqfyykkmvgjfeh-xlpzgreqsa-n
+
** 109722
* molecular-weight:
+
* centisome-position:
** 242.231
+
** 55.243282   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
* [[TPH]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[1.14.11.2-RXN]]
{{#set: common-name=thymidine}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=iqfyykkmvgjfeh-xlpzgreqsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=242.231}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7894]]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=124492}}
 +
{{#set: left-end-position=109722}}
 +
{{#set: centisome-position=55.243282    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ21060

  • transcription-direction:
    • negative
  • right-end-position:
    • 124492
  • left-end-position:
    • 109722
  • centisome-position:
    • 55.243282

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7894
    • 1 reactions found over 6 reactions in the full pathway