Difference between revisions of "Charged-CYS-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12279 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RNA-3-PHOSPHATE-CYCLASE-...") |
(Created page with "Category:metabolite == Metabolite CREATINE == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi-key: ** cvsvtcorwbxhqv-uhfffaoysa-n * molecular-wei...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CREATINE == |
− | == | + | * common-name: |
− | * [[ | + | ** creatine |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(c(=o)[o-])n(c)c(n)=[n+] |
− | * | + | * inchi-key: |
− | * | + | ** cvsvtcorwbxhqv-uhfffaoysa-n |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 131.134 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[CREATINASE-RXN]] | ||
+ | * [[CREATINE-KINASE-RXN]] | ||
+ | * [[CREATININASE-RXN]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[CREATINE-KINASE-RXN]] | ||
+ | * [[CREATININASE-RXN]] | ||
+ | * [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=creatine}} | ||
+ | {{#set: inchi-key=inchikey=cvsvtcorwbxhqv-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=131.134}} |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CREATINE
- common-name:
- creatine
- smiles:
- c(c(=o)[o-])n(c)c(n)=[n+]
- inchi-key:
- cvsvtcorwbxhqv-uhfffaoysa-n
- molecular-weight:
- 131.134