Difference between revisions of "CPD-17351"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16279 == * transcription-direction: ** positive * right-end-position: ** 5692 * left-end-position: ** 145 * centisome-position: ** 2.5283349 ==...")
(Created page with "Category:metabolite == Metabolite CPD-11552 == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * smiles: ** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1) * in...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16279 ==
+
== Metabolite CPD-11552 ==
* transcription-direction:
+
* common-name:
** positive
+
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
* right-end-position:
+
* smiles:
** 5692
+
** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
* left-end-position:
+
* inchi-key:
** 145
+
** ycjnyhccoxvyaf-uhfffaoysa-m
* centisome-position:
+
* molecular-weight:
** 2.5283349   
+
** 222.177
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10721]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-10721]]
* [[6.3.5.7-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}}
* [[AMIDASE-RXN]]
+
{{#set: molecular-weight=222.177}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[PYRAZIN-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[R311-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-14727]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-14728]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-17608]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXNN-404]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-5921]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
* [[ARGDEG-V-PWY]]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-7308]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-5025]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-3161]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-581]]
 
** '''5''' reactions found over '''12''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=5692}}
 
{{#set: left-end-position=145}}
 
{{#set: centisome-position=2.5283349    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=9}}
 
{{#set: nb pathway associated=6}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-11552

  • common-name:
    • 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
  • smiles:
    • c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
  • inchi-key:
    • ycjnyhccoxvyaf-uhfffaoysa-m
  • molecular-weight:
    • 222.177

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality