Difference between revisions of "CPD-12699"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13253 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite QUEUINE == * common-name: ** queuine * smiles: ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n)) * inchi-key: ** wyrolenthwjflr-acldm...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite QUEUINE == |
− | + | * common-name: | |
− | * [ | + | ** queuine |
− | == | + | * smiles: |
− | * | + | ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n)) |
− | + | * inchi-key: | |
− | ** | + | ** wyrolenthwjflr-acldmzeesa-o |
− | * | + | * molecular-weight: |
− | + | ** 278.29 | |
− | ** | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=queuine}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=wyrolenthwjflr-acldmzeesa-o}} |
− | {{#set: | + | {{#set: molecular-weight=278.29}} |
Revision as of 20:30, 18 December 2020
Contents
Metabolite QUEUINE
- common-name:
- queuine
- smiles:
- c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
- inchi-key:
- wyrolenthwjflr-acldmzeesa-o
- molecular-weight:
- 278.29