Difference between revisions of "1-7-DIMETHYLXANTHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08873 == * transcription-direction: ** negative * right-end-position: ** 318566 * left-end-position: ** 286214 * centisome-position: ** 66.51144...")
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * smiles: ** c(op([o-])(occ(co)o)=o)c[n+] * inch...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ08873 ==
+
== Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE ==
* transcription-direction:
+
* common-name:
** negative
+
** sn-glycero-3-phosphoethanolamine
* right-end-position:
+
* smiles:
** 318566
+
** c(op([o-])(occ(co)o)=o)c[n+]
* left-end-position:
+
* inchi-key:
** 286214
+
** jznwscpgtdbmew-rxmqykedsa-n
* centisome-position:
+
* molecular-weight:
** 66.51144   
+
** 215.142
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14160]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-15035]]
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=sn-glycero-3-phosphoethanolamine}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}}
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
+
{{#set: molecular-weight=215.142}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN1G-1435]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN1G-1436]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN1G-1437]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN1G-1438]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN1G-1439]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[TREHALOSE6PSYN-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[TREHALOSEPHOSPHA-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWYG-321]]
 
** '''26''' reactions found over '''182''' reactions in the full pathway
 
* [[TRESYN-PWY]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-7900]]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-881]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[TREHALOSESYN-PWY]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=318566}}
 
{{#set: left-end-position=286214}}
 
{{#set: centisome-position=66.51144    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=9}}
 
{{#set: nb pathway associated=5}}
 

Revision as of 20:30, 18 December 2020

Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE

  • common-name:
    • sn-glycero-3-phosphoethanolamine
  • smiles:
    • c(op([o-])(occ(co)o)=o)c[n+]
  • inchi-key:
    • jznwscpgtdbmew-rxmqykedsa-n
  • molecular-weight:
    • 215.142

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality