Difference between revisions of "OLEOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15712 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.6.4.4-RXN ** Categor...")
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15712 ==
+
== Metabolite CPD-9854 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** 3-(all-trans-heptaprenyl)benzene-1,2-diol
== Reaction(s) associated ==
+
* smiles:
* [[3.6.4.4-RXN]]
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** ooykexozubwosx-nfdzfspwsa-n
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 586.94
 +
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9225]]
 +
== Reaction(s) known to produce the compound ==
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}}
 +
{{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}}
 +
{{#set: molecular-weight=586.94}}

Revision as of 20:30, 18 December 2020

Metabolite CPD-9854

  • common-name:
    • 3-(all-trans-heptaprenyl)benzene-1,2-diol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
  • inchi-key:
    • ooykexozubwosx-nfdzfspwsa-n
  • molecular-weight:
    • 586.94

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality