Difference between revisions of "OLEOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15712 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.6.4.4-RXN ** Categor...") |
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-9854 == |
− | == | + | * common-name: |
− | * | + | ** 3-(all-trans-heptaprenyl)benzene-1,2-diol |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c |
− | + | * inchi-key: | |
− | + | ** ooykexozubwosx-nfdzfspwsa-n | |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 586.94 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9225]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}} | ||
+ | {{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}} | ||
+ | {{#set: molecular-weight=586.94}} |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-9854
- common-name:
- 3-(all-trans-heptaprenyl)benzene-1,2-diol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
- inchi-key:
- ooykexozubwosx-nfdzfspwsa-n
- molecular-weight:
- 586.94