Difference between revisions of "GDP-TP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18962 == * transcription-direction: ** positive * right-end-position: ** 360074 * left-end-position: ** 332769 * centisome-position: ** 51.955135...") |
(Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite NICOTINATE_NUCLEOTIDE == |
− | * | + | * common-name: |
− | ** | + | ** β-nicotinate d-ribonucleotide |
− | + | * smiles: | |
− | * | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) |
− | + | * inchi-key: | |
− | ** | + | ** jouiqrnqjgxqdc-zyuzmqfosa-l |
− | + | * molecular-weight: | |
− | + | ** 333.191 | |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[NICONUCADENYLYLTRAN-RXN]] | |
− | == | + | * [[RXN-14227]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[NICOTINATEPRIBOSYLTRANS-RXN]] | |
− | * | + | * [[QUINOPRIBOTRANS-RXN]] |
− | + | * [[RXN-8443]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=β-nicotinate d-ribonucleotide}} | |
− | + | {{#set: inchi-key=inchikey=jouiqrnqjgxqdc-zyuzmqfosa-l}} | |
− | + | {{#set: molecular-weight=333.191}} | |
− | ** | ||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | * | ||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite NICOTINATE_NUCLEOTIDE
- common-name:
- β-nicotinate d-ribonucleotide
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
- inchi-key:
- jouiqrnqjgxqdc-zyuzmqfosa-l
- molecular-weight:
- 333.191