Difference between revisions of "GLYCYLGLYCINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21424 == * transcription-direction: ** positive * right-end-position: ** 154631 * left-end-position: ** 126229 * centisome-position: ** 65.33626...")
(Created page with "Category:metabolite == Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD == * common-name: ** pelargonidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21424 ==
+
== Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD ==
* transcription-direction:
+
* common-name:
** positive
+
** pelargonidin-3-o-β-d-glucoside
* right-end-position:
+
* smiles:
** 154631
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
* left-end-position:
+
* inchi-key:
** 126229
+
** abvcubuixwjyse-gqupqbgvsa-m
* centisome-position:
+
* molecular-weight:
** 65.33626   
+
** 431.375
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-7828]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.8.2.23-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=pelargonidin-3-o-β-d-glucoside}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
== Pathway(s) associated ==
+
{{#set: molecular-weight=431.375}}
* [[PWY-6558]]
 
** '''7''' reactions found over '''13''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=154631}}
 
{{#set: left-end-position=126229}}
 
{{#set: centisome-position=65.33626    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD

  • common-name:
    • pelargonidin-3-o-β-d-glucoside
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
  • inchi-key:
    • abvcubuixwjyse-gqupqbgvsa-m
  • molecular-weight:
    • 431.375

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality