Difference between revisions of "5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12259 == * transcription-direction: ** negative * right-end-position: ** 159926 * left-end-position: ** 154250 * centisome-position: ** 42.831993...")
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * smiles: ** c2([n+]=cn(c1(oc(cop(...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12259 ==
+
== Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
−
* right-end-position:
+
* smiles:
−
** 159926
+
** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
−
* left-end-position:
+
* inchi-key:
−
** 154250
+
** pdacukokvhbvhj-xvfcmesisa-m
−
* centisome-position:
+
* molecular-weight:
−
** 42.831993   
+
** 294.18
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[AIRCARBOXY-RXN]]
−
== Reaction(s) associated ==
+
* [[PYRIMSYN1-RXN]]
−
* [[1.3.1.20-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[AIRCARBOXY-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AIRS-RXN]]
−
* [[D-XYLOSE-1-DEHYDROGENASE-NADP+-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=5-amino-1-(5-phospho-β-d-ribosyl)imidazole}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=294.18}}
−
* [[PWY-6760]]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=159926}}
 
−
{{#set: left-end-position=154250}}
 
−
{{#set: centisome-position=42.831993    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE

  • common-name:
    • 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
  • smiles:
    • c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
  • inchi-key:
    • pdacukokvhbvhj-xvfcmesisa-m
  • molecular-weight:
    • 294.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE&oldid=46206"