Difference between revisions of "CPD1F-453"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16023 == * transcription-direction: ** positive * right-end-position: ** 379240 * left-end-position: ** 368895 * centisome-position: ** 53.345757...") |
(Created page with "Category:metabolite == Metabolite O-ACETYLCARNITINE == * common-name: ** o-acetyl-l-carnitine * smiles: ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c * inchi-key: ** rdhqfkqigngied-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite O-ACETYLCARNITINE == |
− | * | + | * common-name: |
− | ** | + | ** o-acetyl-l-carnitine |
− | * | + | * smiles: |
− | ** | + | ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c |
− | * | + | * inchi-key: |
− | ** | + | ** rdhqfkqigngied-mrvpvssysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 203.238 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=o-acetyl-l-carnitine}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=rdhqfkqigngied-mrvpvssysa-n}} |
− | {{#set: | + | {{#set: molecular-weight=203.238}} |
− | |||
− | {{#set: | ||
− | |||
− |
Revision as of 20:31, 18 December 2020
Contents
Metabolite O-ACETYLCARNITINE
- common-name:
- o-acetyl-l-carnitine
- smiles:
- cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c
- inchi-key:
- rdhqfkqigngied-mrvpvssysa-n
- molecular-weight:
- 203.238