Difference between revisions of "Plasmanylcholine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16894 == * transcription-direction: ** positive * right-end-position: ** 265481 * left-end-position: ** 249445 * centisome-position: ** 90.47992...")
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16894 ==
+
== Metabolite TAGATOSE-1-6-DIPHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** d-tagatofuranose 1,6-bisphosphate
−
* right-end-position:
+
* smiles:
−
** 265481
+
** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
−
* left-end-position:
+
* inchi-key:
−
** 249445
+
** rnbgygvwrkecfj-oexcpvawsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 90.47992   
+
** 336.085
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[TAGAALDOL-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[UGD-RXN]]
+
* [[TAGAKIN-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=336.085}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[UGDH]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7346]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-7820]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=265481}}
 
−
{{#set: left-end-position=249445}}
 
−
{{#set: centisome-position=90.47992    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:32, 18 December 2020

Metabolite TAGATOSE-1-6-DIPHOSPHATE

  • common-name:
    • d-tagatofuranose 1,6-bisphosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
  • inchi-key:
    • rnbgygvwrkecfj-oexcpvawsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Plasmanylcholine&oldid=46564"