Difference between revisions of "Charged-TYR-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01661 == * transcription-direction: ** negative * right-end-position: ** 149656 * left-end-position: ** 132406 * centisome-position: ** 24.0934...") |
(Created page with "Category:metabolite == Metabolite CPD-7535 == * common-name: ** 9,15,9'-tri-cis-ζ-carotene * smiles: ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7535 == |
| − | * | + | * common-name: |
| − | ** | + | ** 9,15,9'-tri-cis-ζ-carotene |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** biwlelkafxrpde-lmarsqgmsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 540.914 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11354]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-11354]] |
| − | * | + | * [[RXN-11355]] |
| − | * | + | * [[RXN-12244]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=9,15,9'-tri-cis-ζ-carotene}} | |
| − | + | {{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}} | |
| − | {{#set: | + | {{#set: molecular-weight=540.914}} |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-7535
- common-name:
- 9,15,9'-tri-cis-ζ-carotene
- smiles:
- cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- biwlelkafxrpde-lmarsqgmsa-n
- molecular-weight:
- 540.914
