Difference between revisions of "MG+2"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00626 == * transcription-direction: ** negative * right-end-position: ** 266979 * left-end-position: ** 208705 * centisome-position: ** 36.906998...") |
(Created page with "Category:metabolite == Metabolite CPD-18309 == * common-name: ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine * smiles: ** cc(c)c(c([o-])=o)nc(=o)c([n+])cn...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-18309 == |
| − | * | + | * common-name: |
| − | ** | + | ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine |
| − | + | * smiles: | |
| − | + | ** cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1) | |
| − | + | * inchi-key: | |
| − | * | + | ** hcgfosjnuodeoh-rulnzfcnsa-n |
| − | + | * molecular-weight: | |
| − | ** | + | ** 316.313 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-16991]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine}} | |
| − | + | {{#set: inchi-key=inchikey=hcgfosjnuodeoh-rulnzfcnsa-n}} | |
| − | * | + | {{#set: molecular-weight=316.313}} |
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | == | ||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-18309
- common-name:
- n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine
- smiles:
- cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1)
- inchi-key:
- hcgfosjnuodeoh-rulnzfcnsa-n
- molecular-weight:
- 316.313
