Difference between revisions of "4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00229 == * transcription-direction: ** negative * right-end-position: ** 73386 * left-end-position: ** 62485 * centisome-position: ** 10.967937...")
(Created page with "Category:metabolite == Metabolite CPDQT-39 == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** lqqzhlhcfscjc...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00229 ==
+
== Metabolite CPDQT-39 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-[(6'-methylthio)hexyl]malate
−
* right-end-position:
+
* smiles:
−
** 73386
+
** csccccccc(c(o)c(=o)[o-])c(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 62485
+
** lqqzhlhcfscjcu-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 10.967937   
+
** 262.32
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-18202]]
−
== Reaction(s) associated ==
+
* [[RXNQT-4174]]
−
* [[GLYOXIII-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-18202]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[THIAZOLSYN3-RXN]]
+
{{#set: common-name=3-[(6'-methylthio)hexyl]malate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=262.32}}
−
== Pathway(s) associated ==
 
−
* [[PWY-7357]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7356]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6897]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=73386}}
 
−
{{#set: left-end-position=62485}}
 
−
{{#set: centisome-position=10.967937    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPDQT-39

  • common-name:
    • 3-[(6'-methylthio)hexyl]malate
  • smiles:
    • csccccccc(c(o)c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • lqqzhlhcfscjcu-uhfffaoysa-l
  • molecular-weight:
    • 262.32

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "3-[(6'-methylthio)hexyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.


Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON&oldid=47333"