Difference between revisions of "Very-Long-Chain-Trans-23-Dehydroacyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12379 RXN-12379] == * direction: ** left-to-right * common-name: ** trna (n2-methylguanine26-n2...")
(Created page with "Category:metabolite == Metabolite GMP == * common-name: ** gmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** rqfcjasxjcidsx-...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12379 RXN-12379] ==
+
== Metabolite GMP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna (n2-methylguanine26-n2-methyltransferase
+
** gmp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.215 ec-2.1.1.215]
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[tRNA-Containing-N2-Methylgua-26-Gua27]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNA-Containing-N2-Dimethylgua-26-Gua27]][c]
+
** rqfcjasxjcidsx-uuokfmhzsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09381]]
+
** 361.207
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[AGPT]]
−
* Gene: [[SJ14807]]
+
* [[GMP-REDUCT-RXN]]
−
** Category: [[annotation]]
+
* [[GUANPRIBOSYLTRAN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GUANYL-KIN-RXN]]
−
== Pathway(s)  ==
+
* [[RXN-7609]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[3.6.1.17-RXN]]
−
== External links  ==
+
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[GMP-SYN-GLUT-RXN]]
−
{{#set: common-name=trna (n2-methylguanine26-n2-methyltransferase}}
+
* [[GMP-SYN-NH3-RXN]]
−
{{#set: ec-number=ec-2.1.1.215}}
+
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
−
{{#set: nb gene associated=2}}
+
* [[GUANPRIBOSYLTRAN-RXN]]
−
{{#set: nb pathway associated=0}}
+
* [[NTDP]]
−
{{#set: reconstruction category=annotation}}
+
* [[RXN-14140]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[RXN-14201]]
−
{{#set: reconstruction comment=n.a}}
+
* [[RXN-15713]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[RXN-17923]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=gmp}}
 +
{{#set: inchi-key=inchikey=rqfcjasxjcidsx-uuokfmhzsa-l}}
 +
{{#set: molecular-weight=361.207}}

Revision as of 20:35, 18 December 2020

Metabolite GMP

  • common-name:
    • gmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • rqfcjasxjcidsx-uuokfmhzsa-l
  • molecular-weight:
    • 361.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Very-Long-Chain-Trans-23-Dehydroacyl-CoA&oldid=47493"