Difference between revisions of "OHyW-58-tRNAPhe"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-723 RXN0-723] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:metabolite == Metabolite CPD-182 == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) * inchi-key: ** hshnitrmyyllcv-uhfffaoysa-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-182 == |
− | * | + | * common-name: |
− | ** | + | ** 4-methylumbelliferone |
− | * | + | * smiles: |
− | ** | + | ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) |
− | = | + | * inchi-key: |
− | + | ** hshnitrmyyllcv-uhfffaoysa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 176.171 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[3.1.1.56-RXN]] |
− | + | * [[RXN-10769]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | {{#set: common-name=4-methylumbelliferone}} |
− | * | + | {{#set: inchi-key=inchikey=hshnitrmyyllcv-uhfffaoysa-n}} |
− | + | {{#set: molecular-weight=176.171}} | |
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-182
- common-name:
- 4-methylumbelliferone
- smiles:
- cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
- inchi-key:
- hshnitrmyyllcv-uhfffaoysa-n
- molecular-weight:
- 176.171