|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREDEHYD-RXN THREDEHYD-RXN] == | + | == Metabolite SQUALENE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** l-threonine deaminase | + | ** squalene |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.3.1.19 ec-4.3.1.19] | + | ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[THR]][c] '''=>''' 1 [[2-OXOBUTANOATE]][c] '''+''' 1 [[AMMONIUM]][c]
| + | ** yygntywphwgjrm-aajylucbsa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ10955]] | + | ** 410.725 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[SMO]] |
| − | ** Category: [[orthology]]
| + | * [[SQUALENE-MONOOXYGENASE-RXN]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-13162]] |
| − | * Gene: [[SJ08066]]
| + | * [[RXN-13724]] |
| − | ** Category: [[annotation]]
| + | * [[RXN66-281]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[SMO]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: common-name=squalene}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=410.725}} |
| − | * [[PWY66-428]], L-threonine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-428 PWY66-428]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22109 22109]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00996 R00996]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P25306 P25306]
| |
| − | ** [http://www.uniprot.org/uniprot/Q04513 Q04513]
| |
| − | ** [http://www.uniprot.org/uniprot/P37946 P37946]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JZW1 Q9JZW1]
| |
| − | ** [http://www.uniprot.org/uniprot/Q02145 Q02145]
| |
| − | ** [http://www.uniprot.org/uniprot/P66897 P66897]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9WYJ1 Q9WYJ1]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PP95 Q9PP95]
| |
| − | ** [http://www.uniprot.org/uniprot/P25379 P25379]
| |
| − | ** [http://www.uniprot.org/uniprot/P00927 P00927]
| |
| − | ** [http://www.uniprot.org/uniprot/P20506 P20506]
| |
| − | ** [http://www.uniprot.org/uniprot/P0AGF6 P0AGF6]
| |
| − | ** [http://www.uniprot.org/uniprot/P04968 P04968]
| |
| − | ** [http://www.uniprot.org/uniprot/P20132 P20132]
| |
| − | ** [http://www.uniprot.org/uniprot/P09367 P09367]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9RWU8 Q9RWU8]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JUX5 Q9JUX5]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZD93 Q9ZD93]
| |
| − | ** [http://www.uniprot.org/uniprot/P31212 P31212]
| |
| − | ** [http://www.uniprot.org/uniprot/P36007 P36007]
| |
| − | ** [http://www.uniprot.org/uniprot/P73375 P73375]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9T0D1 Q9T0D1]
| |
| − | ** [http://www.uniprot.org/uniprot/Q39469 Q39469]
| |
| − | ** [http://www.uniprot.org/uniprot/Q93968 Q93968]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9XAA4 Q9XAA4]
| |
| − | ** [http://www.uniprot.org/uniprot/O94634 O94634]
| |
| − | ** [http://www.uniprot.org/uniprot/O59791 O59791]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=l-threonine deaminase}} | |
| − | {{#set: ec-number=ec-4.3.1.19}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
