Difference between revisions of "CPD-11770"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN0-460 TRANS-RXN0-460] == * direction: ** reversible == Reaction formula == * 1 UREA[c]...")
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN0-460 TRANS-RXN0-460] ==
+
== Metabolite OLEATE-CPD ==
−
* direction:
+
* common-name:
−
** reversible
+
** oleate
−
== Reaction formula ==
+
* smiles:
−
* 1 [[UREA]][c] '''<=>''' 1 [[UREA]][e]
+
** ccccccccc=ccccccccc([o-])=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ18129]]
+
** zqppmhvwecsirj-ktkrtigzsa-m
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 281.457
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to consume the compound ==
−
== Pathway(s)  ==
+
* [[FACOAL18111Z]]
−
== Reconstruction information  ==
+
* [[RXN-10756]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-9644]]
−
== External links  ==
+
* [[RXN0-7239]]
−
{{#set: direction=reversible}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: nb gene associated=1}}
+
* [[FACOAE18111Z]]
−
{{#set: nb pathway associated=0}}
+
* [[RXN-10756]]
−
{{#set: reconstruction category=orthology}}
+
* [[RXN-15035]]
−
{{#set: reconstruction tool=pantograph}}
+
* [[RXN-15067]]
−
{{#set: reconstruction comment=n.a}}
+
* [[RXN-15068]]
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
* [[RXN-15088]]
 +
* [[RXN-15089]]
 +
* [[RXN-15133]]
 +
* [[RXN-15135]]
 +
* [[RXN-9666]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=oleate}}
 +
{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
 +
{{#set: molecular-weight=281.457}}

Revision as of 20:36, 18 December 2020

Metabolite OLEATE-CPD

  • common-name:
    • oleate
  • smiles:
    • ccccccccc=ccccccccc([o-])=o
  • inchi-key:
    • zqppmhvwecsirj-ktkrtigzsa-m
  • molecular-weight:
    • 281.457

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11770&oldid=47889"