Difference between revisions of "Pyruvate-dehydrogenase-acetylDHlipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16821 RXN-16821] == * direction: ** left-to-right * common-name: ** trna-5-taurinomethyluridine...")
(Created page with "Category:metabolite == Metabolite CPD-10608 == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgxazmfwnh-onegzznksa-m *...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16821 RXN-16821] ==
+
== Metabolite CPD-10608 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna-5-taurinomethyluridine 2-sulfurtransferase
+
** trans-dienelactone
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.8.1.14 ec-2.8.1.14]
+
** c1(=cc(=o)oc(=cc(=o)[o-])1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[TUM1-S-sulfanylcysteine]][c] '''+''' 1 [[tRNA-containing-5-taurinomethyluridine]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[TUM1-L-cysteine]][c] '''+''' 1 [[tRNA-with-5-taurinomethyl-2-thiouridine]][c]
+
** ayfxpgxazmfwnh-onegzznksa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13939]]
+
** 139.087
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-9868]]
−
* Gene: [[SJ00619]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=trans-dienelactone}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
−
* [[PWY-7889]], tRNA-uridine 2-thiolation (mammalian mitochondria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7889 PWY-7889]
+
{{#set: molecular-weight=139.087}}
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna-5-taurinomethyluridine 2-sulfurtransferase}}
 
−
{{#set: ec-number=ec-2.8.1.14}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-10608

  • common-name:
    • trans-dienelactone
  • smiles:
    • c1(=cc(=o)oc(=cc(=o)[o-])1)
  • inchi-key:
    • ayfxpgxazmfwnh-onegzznksa-m
  • molecular-weight:
    • 139.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Pyruvate-dehydrogenase-acetylDHlipoyl&oldid=48048"