Difference between revisions of "Protein-N-acetyl-D-glucosamine-L-thr"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=X-METHYL-HIS-DIPEPTIDASE-RXN X-METHYL-HIS-DIPEPTIDASE-RXN] == * direction: ** left-to-right * commo...")
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=X-METHYL-HIS-DIPEPTIDASE-RXN X-METHYL-HIS-DIPEPTIDASE-RXN] ==
+
== Metabolite CPD-6993 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** β-alanyl-nπ-methyl-l-histidine hydrolase
+
** pinocembrin chalcone
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.4.13.5 ec-3.4.13.5]
+
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-401]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[B-ALANINE]][c] '''+''' 1 [[CPD-1823]][c]
+
** loyxtwzxlwhmbx-votsokgwsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19529]]
+
** 256.257
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-7647]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-7645]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=pinocembrin chalcone}}
−
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R03288 R03288]
+
{{#set: molecular-weight=256.257}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=β-alanyl-nπ-methyl-l-histidine hydrolase}}
 
−
{{#set: ec-number=ec-3.4.13.5}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-6993

  • common-name:
    • pinocembrin chalcone
  • smiles:
    • c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
  • inchi-key:
    • loyxtwzxlwhmbx-votsokgwsa-n
  • molecular-weight:
    • 256.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Protein-N-acetyl-D-glucosamine-L-thr&oldid=48292"