Difference between revisions of "25S-rRNA-adenine-2142"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.271-RXN 1.1.1.271-RXN] == * direction: ** left-to-right * common-name: ** gdp-fucose synthase...")
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=c...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.271-RXN 1.1.1.271-RXN] ==
+
== Metabolite CPD-12117 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** gdp-fucose synthase
+
** demethylmenaquinol-7
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.1.271 ec-1.1.1.271]
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
== Reaction formula ==
+
* inchi-key:
* 1 [[GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-13118]][c] '''+''' 1 [[NADP]][c]
+
** ufzdimbxtvrbds-ssqlmynasa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ05880]]
+
** 636.999
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-9191]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=demethylmenaquinol-7}}
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
* [[PWY-66]], GDP-L-fucose biosynthesis I (from GDP-D-mannose): [http://metacyc.org/META/NEW-IMAGE?object=PWY-66 PWY-66]
+
{{#set: molecular-weight=636.999}}
** '''2''' reactions found over '''3''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18887 18887]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R05692 R05692]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=gdp-fucose synthase}}
 
{{#set: ec-number=ec-1.1.1.271}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-12117

  • common-name:
    • demethylmenaquinol-7
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • ufzdimbxtvrbds-ssqlmynasa-n
  • molecular-weight:
    • 636.999

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality