Difference between revisions of "CPD-8093"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHALCONE-ISOMERASE-RXN CHALCONE-ISOMERASE-RXN] == * direction: ** reversible * common-name: ** chal...")
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHALCONE-ISOMERASE-RXN CHALCONE-ISOMERASE-RXN] ==
+
== Metabolite FRUCTOSE-6P ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** chalcone isomerase
+
** β-d-fructofuranose 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/5.5.1.6 ec-5.5.1.6]
+
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Chalcones]][c] '''<=>''' 1 [[FLAVANONES]][c]
+
** bgwgxpapygqalx-arqdhwqxsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09285]]
+
** 258.121
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[2.7.1.90-RXN]]
−
* Gene: [[SJ20427]]
+
* [[2TRANSKETO-RXN]]
−
** Category: [[annotation]]
+
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[6PFRUCTPHOS-RXN]]
−
== Pathway(s)  ==
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
== Reconstruction information  ==
+
* [[MANNPDEHYDROG-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[MANNPISOM-RXN]]
−
== External links  ==
+
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
−
* LIGAND-RXN:
+
* [[PFK_]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R07344 R07344]
+
* [[PGIA]]
−
* UNIPROT:
+
* [[PGIAh]]
−
** [http://www.uniprot.org/uniprot/P11650 P11650]
+
* [[PGIB]]
−
** [http://www.uniprot.org/uniprot/P11651 P11651]
+
* [[PGIBh]]
−
** [http://www.uniprot.org/uniprot/P41088 P41088]
+
* [[PGLUCISOM-RXN]]
−
** [http://www.uniprot.org/uniprot/P14298 P14298]
+
* [[RXN-14812]]
−
** [http://www.uniprot.org/uniprot/Q42925 Q42925]
+
* [[TRANSALDOL-RXN]]
−
** [http://www.uniprot.org/uniprot/Q42926 Q42926]
+
== Reaction(s) known to produce the compound ==
−
** [http://www.uniprot.org/uniprot/Q08704 Q08704]
+
* [[2.7.1.90-RXN]]
−
** [http://www.uniprot.org/uniprot/P28012 P28012]
+
* [[2TRANSKETO-RXN]]
−
** [http://www.uniprot.org/uniprot/P41089 P41089]
+
* [[3.1.3.46-RXN]]
−
** [http://www.uniprot.org/uniprot/O81980 O81980]
+
* [[F16BDEPHOS-RXN]]
−
** [http://www.uniprot.org/uniprot/O22604 O22604]
+
* [[FRUCTOKINASE-RXN]]
−
** [http://www.uniprot.org/uniprot/O22651 O22651]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
** [http://www.uniprot.org/uniprot/Q43754 Q43754]
+
* [[MANNPDEHYDROG-RXN]]
−
{{#set: direction=reversible}}
+
* [[MANNPISOM-RXN]]
−
{{#set: common-name=chalcone isomerase}}
+
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
−
{{#set: ec-number=ec-5.5.1.6}}
+
* [[PGIA]]
−
{{#set: nb gene associated=2}}
+
* [[PGIAh]]
−
{{#set: nb pathway associated=0}}
+
* [[PGIB]]
−
{{#set: reconstruction category=annotation}}
+
* [[PGIBh]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[PGLUCISOM-RXN]]
−
{{#set: reconstruction comment=n.a}}
+
* [[RXN-14812]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[TRANSALDOL-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=&beta;-d-fructofuranose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
 +
{{#set: molecular-weight=258.121}}

Revision as of 20:37, 18 December 2020

Metabolite FRUCTOSE-6P

  • common-name:
    • β-d-fructofuranose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
  • inchi-key:
    • bgwgxpapygqalx-arqdhwqxsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8093&oldid=48497"