Difference between revisions of "D-MYO-INOSITOL-4-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] == * direction: ** left-to-right * common-name: ** epi-sterol-desaturase * ec-...") |
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CARNITINE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** l-carnitine |
− | * | + | * smiles: |
− | ** | + | ** c(c(o)cc(=o)[o-])[n+](c)(c)c |
− | + | * inchi-key: | |
− | + | ** phiqhxfuzvpyii-zcfiwibfsa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 161.2 |
− | + | == Reaction(s) known to consume the compound == | |
− | ** | + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] |
− | * | + | * [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]] |
− | ** | + | * [[RXN-9918]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[1.14.11.1-RXN]] |
− | * | + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] |
− | * | + | * [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]] |
− | == | + | * [[RXN-9918]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=l-carnitine}} | |
− | * [[ | + | {{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}} |
− | + | {{#set: molecular-weight=161.2}} | |
− | |||
− | |||
− | * | ||
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:38, 18 December 2020
Contents
Metabolite CARNITINE
- common-name:
- l-carnitine
- smiles:
- c(c(o)cc(=o)[o-])[n+](c)(c)c
- inchi-key:
- phiqhxfuzvpyii-zcfiwibfsa-n
- molecular-weight:
- 161.2