Difference between revisions of "SJ11118"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16259 == * transcription-direction: ** negative * right-end-position: ** 689187 * left-end-position: ** 681130 * centisome-position: ** 98.76602...")
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16259 ==
+
== Metabolite GLN ==
* transcription-direction:
+
* common-name:
** negative
+
** l-glutamine
* right-end-position:
+
* smiles:
** 689187
+
** c(=o)(n)ccc([n+])c([o-])=o
* left-end-position:
+
* inchi-key:
** 681130
+
** zdxpyrjpndtmrx-vkhmyheasa-n
* centisome-position:
+
* molecular-weight:
** 98.76602   
+
** 146.146
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_sterols_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[2.6.1.64-RXN]]
* [[1.14.13.8-RXN]]
+
* [[6.3.5.6-RXN]]
** Category: [[annotation]]
+
* [[6.3.5.7-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ANTHRANSYN-RXN]]
* [[RXN66-81]]
+
* [[ASNSYNB-RXN]]
** Category: [[annotation]]
+
* [[CARBPSYN-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[CTPSYN-RXN]]
* [[RXNDQC-2]]
+
* [[FGAMSYN-RXN]]
** Category: [[annotation]]
+
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
== Pathway(s) associated ==
+
* [[GLUTAMATESYN-RXN]]
* [[PWY66-201]]
+
* [[GLUTAMIDOTRANS-RXN]]
** '''3''' reactions found over '''16''' reactions in the full pathway
+
* [[GLUTAMIN-RXN]]
* [[PWYDQC-4]]
+
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[GMP-SYN-GLUT-RXN]]
* [[PWY-581]]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
** '''5''' reactions found over '''12''' reactions in the full pathway
+
* [[NAD-SYNTH-GLN-RXN]]
{{#set: transcription-direction=negative}}
+
* [[PABASYN-RXN]]
{{#set: right-end-position=689187}}
+
* [[PRPPAMIDOTRANS-RXN]]
{{#set: left-end-position=681130}}
+
* [[RXN-11322]]
{{#set: centisome-position=98.76602    }}
+
* [[biomass_rxn]]
{{#set: organism associated=S.japonica_sterols_curated}}
+
</div>
{{#set: nb reaction associated=3}}
+
== Reaction(s) known to produce the compound ==
{{#set: nb pathway associated=3}}
+
* [[2.6.1.64-RXN]]
 +
* [[ANTHRANSYN-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[RXN0-6976]]
 +
* [[RXN0-6983]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=l-glutamine}}
 +
{{#set: inchi-key=inchikey=zdxpyrjpndtmrx-vkhmyheasa-n}}
 +
{{#set: molecular-weight=146.146}}

Revision as of 14:53, 5 January 2021