Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CREATINE-P == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] * inchi-key: ** drbbfclwyr...") |
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine == * common-name: ** a [dna ligase]-l-lysine == Reaction(s) known to consume the compound == * RXN-17917 * RXN-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-Ligase-L-lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [dna ligase]-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17917]] |
| + | * [[RXN-17920]] | ||
| + | * [[RXN-17921]] | ||
| + | * [[RXN-17924]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17918]] |
| + | * [[RXN-17922]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [dna ligase]-l-lysine}} |
| − | |||
| − | |||
Revision as of 14:53, 5 January 2021
Contents
Metabolite DNA-Ligase-L-lysine
- common-name:
- a [dna ligase]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [dna ligase]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
