Difference between revisions of "OLEOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
(Created page with "Category:metabolite == Metabolite Long-chain-alcohols == * common-name: ** a long-chain alcohol == Reaction(s) known to consume the compound == * 2.3.1.75-RXN * ALKY...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9854 ==
+
== Metabolite Long-chain-alcohols ==
 
* common-name:
 
* common-name:
** 3-(all-trans-heptaprenyl)benzene-1,2-diol
+
** a long-chain alcohol
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
 
* inchi-key:
 
** ooykexozubwosx-nfdzfspwsa-n
 
* molecular-weight:
 
** 586.94
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9225]]
+
* [[2.3.1.75-RXN]]
 +
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
 +
* [[RXN-4444]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}}
+
{{#set: common-name=a long-chain alcohol}}
{{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}}
 
{{#set: molecular-weight=586.94}}
 

Revision as of 14:53, 5 January 2021

Metabolite Long-chain-alcohols

  • common-name:
    • a long-chain alcohol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality