Difference between revisions of "CPD-18447"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYSTINE == * common-name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi-key: ** levwyrkdkasidu-imjsidkusa-n *...") |
(Created page with "Category:metabolite == Metabolite CPD-10472 == * common-name: ** 3-dimethylsulfoniopropionaldehyde * smiles: ** c[s+](c)ccc=o * inchi-key: ** oisjaayqhibaqp-uhfffaoysa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10472 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-dimethylsulfoniopropionaldehyde |
* smiles: | * smiles: | ||
− | ** c | + | ** c[s+](c)ccc=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oisjaayqhibaqp-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 119.201 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-9758]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-dimethylsulfoniopropionaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oisjaayqhibaqp-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=119.201}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-10472
- common-name:
- 3-dimethylsulfoniopropionaldehyde
- smiles:
- c[s+](c)ccc=o
- inchi-key:
- oisjaayqhibaqp-uhfffaoysa-n
- molecular-weight:
- 119.201