Difference between revisions of "CPD-8646"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-535 == * common-name: ** β-d-fructose 2,6-bisphosphate * smiles: ** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-] * inc...")
(Created page with "Category:metabolite == Metabolite Oxidized-adrenal-ferredoxins == * common-name: ** an oxidized adrenodoxin == Reaction(s) known to consume the compound == * RXN-13685...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-535 ==
+
== Metabolite Oxidized-adrenal-ferredoxins ==
 
* common-name:
 
* common-name:
** β-d-fructose 2,6-bisphosphate
+
** an oxidized adrenodoxin
* smiles:
 
** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-]
 
* inchi-key:
 
** yxwoajxnvlxpmu-zxxmmsqzsa-j
 
* molecular-weight:
 
** 336.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.46-RXN]]
+
* [[RXN-13685]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructose 2,6-bisphosphate}}
+
{{#set: common-name=an oxidized adrenodoxin}}
{{#set: inchi-key=inchikey=yxwoajxnvlxpmu-zxxmmsqzsa-j}}
 
{{#set: molecular-weight=336.085}}
 

Revision as of 14:54, 5 January 2021

Metabolite Oxidized-adrenal-ferredoxins

  • common-name:
    • an oxidized adrenodoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality