Difference between revisions of "GLYCYLGLYCINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD == * common-name: ** pelargonidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([...")
(Created page with "Category:metabolite == Metabolite CPD-8132 == * common-name: ** thiophenol * smiles: ** c1(c=cc(=cc=1)[s-]) * inchi-key: ** rmvrsndyefqclf-uhfffaoysa-m * molecular-weight:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD ==
+
== Metabolite CPD-8132 ==
 
* common-name:
 
* common-name:
** pelargonidin-3-o-β-d-glucoside
+
** thiophenol
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
+
** c1(c=cc(=cc=1)[s-])
 
* inchi-key:
 
* inchi-key:
** abvcubuixwjyse-gqupqbgvsa-m
+
** rmvrsndyefqclf-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 431.375
+
** 109.165
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7828]]
+
* [[RXN-13726]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pelargonidin-3-o-β-d-glucoside}}
+
{{#set: common-name=thiophenol}}
{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
+
{{#set: inchi-key=inchikey=rmvrsndyefqclf-uhfffaoysa-m}}
{{#set: molecular-weight=431.375}}
+
{{#set: molecular-weight=109.165}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-8132

  • common-name:
    • thiophenol
  • smiles:
    • c1(c=cc(=cc=1)[s-])
  • inchi-key:
    • rmvrsndyefqclf-uhfffaoysa-m
  • molecular-weight:
    • 109.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality