Difference between revisions of "CPD-17815"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHTYOSPHINGOSINE-1-P == * common-name: ** phytosphingosine 1-phosphate * smiles: ** ccccccccccccccc(o)c(c(cop([o-])(=o)[o-])[n+])o * inch...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONYL-COA == * common-name: ** 3-hydroxypropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-HYDROXY-PROPIONYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-hydroxypropanoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** berbfzcusmqabm-iexphmlfsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 835.566 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[HICH]] |
+ | * [[RXN-6383]] | ||
+ | * [[RXN-6384]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-6383]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-hydroxypropanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=berbfzcusmqabm-iexphmlfsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=835.566}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite 3-HYDROXY-PROPIONYL-COA
- common-name:
- 3-hydroxypropanoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- berbfzcusmqabm-iexphmlfsa-j
- molecular-weight:
- 835.566