Difference between revisions of "CPD-13174"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite a-glycopeptide-D-mannosyl-Nsup4sup-N-ace == * common-name: ** a glycopeptide-d-mannosyl-n4-(n-acetyl-d-glucosaminyl)2-asparagine == React...")
(Created page with "Category:metabolite == Metabolite CPD-2751 == * common-name: ** 5'-hydroxycotinine * smiles: ** c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2)) * inchi-key: ** bbnhnzgtkswihd-snvbaglbs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite a-glycopeptide-D-mannosyl-Nsup4sup-N-ace ==
+
== Metabolite CPD-2751 ==
 
* common-name:
 
* common-name:
** a glycopeptide-d-mannosyl-n4-(n-acetyl-d-glucosaminyl)2-asparagine
+
** 5'-hydroxycotinine
 +
* smiles:
 +
** c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2))
 +
* inchi-key:
 +
** bbnhnzgtkswihd-snvbaglbsa-n
 +
* molecular-weight:
 +
** 192.217
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.96-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-163]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a glycopeptide-d-mannosyl-n4-(n-acetyl-d-glucosaminyl)2-asparagine}}
+
{{#set: common-name=5'-hydroxycotinine}}
 +
{{#set: inchi-key=inchikey=bbnhnzgtkswihd-snvbaglbsa-n}}
 +
{{#set: molecular-weight=192.217}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-2751

  • common-name:
    • 5'-hydroxycotinine
  • smiles:
    • c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2))
  • inchi-key:
    • bbnhnzgtkswihd-snvbaglbsa-n
  • molecular-weight:
    • 192.217

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality