Difference between revisions of "PORPHOBILINOGEN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11497 == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(o)c=cc(c(o)co)=c1) * inchi-key: ** fbwpwwwzwkpjfl-qmm...") |
(Created page with "Category:metabolite == Metabolite CADAVERINE == * common-name: ** cadaverine * smiles: ** c([n+])cccc[n+] * inchi-key: ** vhrgrcvqafmjiz-uhfffaoysa-p * molecular-weight: *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CADAVERINE == |
* common-name: | * common-name: | ||
− | ** | + | ** cadaverine |
* smiles: | * smiles: | ||
− | ** | + | ** c([n+])cccc[n+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vhrgrcvqafmjiz-uhfffaoysa-p |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 104.195 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5217]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cadaverine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vhrgrcvqafmjiz-uhfffaoysa-p}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=104.195}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CADAVERINE
- common-name:
- cadaverine
- smiles:
- c([n+])cccc[n+]
- inchi-key:
- vhrgrcvqafmjiz-uhfffaoysa-p
- molecular-weight:
- 104.195