Difference between revisions of "CPD1F-453"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-ACETYLCARNITINE == * common-name: ** o-acetyl-l-carnitine * smiles: ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c * inchi-key: ** rdhqfkqigngied-...")
(Created page with "Category:metabolite == Metabolite 3-Beta-Hydroxysterols == * common-name: ** a 3β-hydroxysteroid == Reaction(s) known to consume the compound == * RXN-13686 == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-ACETYLCARNITINE ==
+
== Metabolite 3-Beta-Hydroxysterols ==
 
* common-name:
 
* common-name:
** o-acetyl-l-carnitine
+
** a 3β-hydroxysteroid
* smiles:
 
** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c
 
* inchi-key:
 
** rdhqfkqigngied-mrvpvssysa-n
 
* molecular-weight:
 
** 203.238
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-13686]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-13686]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-acetyl-l-carnitine}}
+
{{#set: common-name=a 3β-hydroxysteroid}}
{{#set: inchi-key=inchikey=rdhqfkqigngied-mrvpvssysa-n}}
 
{{#set: molecular-weight=203.238}}
 

Revision as of 14:55, 5 January 2021

Metabolite 3-Beta-Hydroxysterols

  • common-name:
    • a 3β-hydroxysteroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality