Difference between revisions of "CPD1F-453"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-ACETYLCARNITINE == * common-name: ** o-acetyl-l-carnitine * smiles: ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c * inchi-key: ** rdhqfkqigngied-...") |
(Created page with "Category:metabolite == Metabolite 3-Beta-Hydroxysterols == * common-name: ** a 3β-hydroxysteroid == Reaction(s) known to consume the compound == * RXN-13686 == Re...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-Beta-Hydroxysterols == |
* common-name: | * common-name: | ||
− | ** | + | ** a 3β-hydroxysteroid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13686]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13686]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 3β-hydroxysteroid}} |
− | |||
− |
Revision as of 14:55, 5 January 2021
Contents
Metabolite 3-Beta-Hydroxysterols
- common-name:
- a 3β-hydroxysteroid