Difference between revisions of "CPD-177"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-177 == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 3-phosphate == Reaction(s) known to consume the compound == * 2.7.1.150-R...")
(Created page with "Category:metabolite == Metabolite CPD-11401 == * common-name: ** l-thyroxine acyl β-d-glucuronide * smiles: ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-177 ==
+
== Metabolite CPD-11401 ==
 
* common-name:
 
* common-name:
** a 1-phosphatidyl-1d-myo-inositol 3-phosphate
+
** l-thyroxine acyl β-d-glucuronide
 +
* smiles:
 +
** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
 +
* inchi-key:
 +
** hmtfxpjobpioin-dkbymcrtsa-m
 +
* molecular-weight:
 +
** 951.992
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.150-RXN]]
 
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
+
* [[RXN-10608]]
* [[3.1.3.66-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 3-phosphate}}
+
{{#set: common-name=l-thyroxine acyl β-d-glucuronide}}
 +
{{#set: inchi-key=inchikey=hmtfxpjobpioin-dkbymcrtsa-m}}
 +
{{#set: molecular-weight=951.992}}

Revision as of 14:55, 5 January 2021

Metabolite CPD-11401

  • common-name:
    • l-thyroxine acyl β-d-glucuronide
  • smiles:
    • c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
  • inchi-key:
    • hmtfxpjobpioin-dkbymcrtsa-m
  • molecular-weight:
    • 951.992

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality