Difference between revisions of "PROTEIN-C-TERMINAL-S-ETC-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19157 == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-19157 ==
+
== Metabolite CPD-13524 ==
 
* common-name:
 
* common-name:
−
** 3-oxo-(7z)-tetradecenoyl-coa
+
** all-trans-retinol
 
* smiles:
 
* smiles:
−
** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 
* inchi-key:
 
* inchi-key:
−
** bepllrgjvxaeji-twafkmgksa-j
+
** fpipgxgpppqfeq-ovsjkpmpsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 985.829
+
** 286.456
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-17795]]
+
* [[1.3.99.23-RXN]]
 +
* [[RETINOL-DEHYDROGENASE-RXN]]
 +
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 +
* [[RXN-10841]]
 +
* [[RXN-12547]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17794]]
+
* [[3.1.1.64-RXN]]
 +
* [[RETINOL-DEHYDROGENASE-RXN]]
 +
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 +
* [[RXN-10841]]
 +
* [[RXN-12575]]
 +
* [[RXN-12579]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}}
+
{{#set: common-name=all-trans-retinol}}
−
{{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}}
+
{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
−
{{#set: molecular-weight=985.829}}
+
{{#set: molecular-weight=286.456}}

Revision as of 14:55, 5 January 2021

Metabolite CPD-13524

  • common-name:
    • all-trans-retinol
  • smiles:
    • cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
  • inchi-key:
    • fpipgxgpppqfeq-ovsjkpmpsa-n
  • molecular-weight:
    • 286.456

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PROTEIN-C-TERMINAL-S-ETC-CYSTEINE&oldid=59421"