Difference between revisions of "Lipoprotein-signal-peptide"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-693 == * common-name: ** 2-cis-abscisate * smiles: ** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** jlidbldqvayhne-ykal...") |
(Created page with "Category:metabolite == Metabolite CPD-7033 == * common-name: ** 2-methylbutanol * smiles: ** ccc(co)c * inchi-key: ** qprqedxdyozyla-uhfffaoysa-n * molecular-weight: ** 88...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7033 == |
* common-name: | * common-name: | ||
| − | ** 2- | + | ** 2-methylbutanol |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(co)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qprqedxdyozyla-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 88.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7694]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=2-methylbutanol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qprqedxdyozyla-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=88.149}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-7033
- common-name:
- 2-methylbutanol
- smiles:
- ccc(co)c
- inchi-key:
- qprqedxdyozyla-uhfffaoysa-n
- molecular-weight:
- 88.149
