Difference between revisions of "DNA-containing-diamino-hydro-formamidops"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-containing-diamino-hydro-formamidops == * common-name: ** a ring-opened 7-methylguanine in dna == Reaction(s) known to consume the co...") |
(Created page with "Category:metabolite == Metabolite L-THYROXINE == * common-name: ** l-thyroxine * smiles: ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-THYROXINE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-thyroxine |
+ | * smiles: | ||
+ | ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) | ||
+ | * inchi-key: | ||
+ | ** xuiikfgfijcvmt-lbprgkrzsa-n | ||
+ | * molecular-weight: | ||
+ | ** 776.874 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10606]] |
+ | * [[RXN-10608]] | ||
+ | * [[RXN-10614]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-thyroxine}} |
+ | {{#set: inchi-key=inchikey=xuiikfgfijcvmt-lbprgkrzsa-n}} | ||
+ | {{#set: molecular-weight=776.874}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite L-THYROXINE
- common-name:
- l-thyroxine
- smiles:
- c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
- inchi-key:
- xuiikfgfijcvmt-lbprgkrzsa-n
- molecular-weight:
- 776.874