Difference between revisions of "CPD-2181"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10793 == * common-name: ** hydroxypyruvaldehyde phosphate * smiles: ** [ch](=o)c(=o)cop(=o)([o-])[o-] * inchi-key: ** nzaaqwrnvfekme-...") |
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O == * common-name: ** prostaglandin d2 * smiles: ** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O == |
* common-name: | * common-name: | ||
| − | ** | + | ** prostaglandin d2 |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bhmbvrspmrccgg-outuxvnysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 351.462 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[1.1.1.188-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.1.1.188-RXN]] | ||
| + | * [[PROSTAGLANDIN-D-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=prostaglandin d2}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bhmbvrspmrccgg-outuxvnysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=351.462}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O
- common-name:
- prostaglandin d2
- smiles:
- cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
- inchi-key:
- bhmbvrspmrccgg-outuxvnysa-m
- molecular-weight:
- 351.462
