Difference between revisions of "CPD-11241"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** h...") |
(Created page with "Category:metabolite == Metabolite Protein-pi-phospho-L-histidines == * common-name: ** a [protein]-nπ-phospho-l-histidine == Reaction(s) known to consume the compound =...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-pi-phospho-L-histidines == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-nπ-phospho-l-histidine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15509]] |
− | * [[ | + | * [[RXN-15510]] |
− | * [[ | + | * [[RXN-15511]] |
− | + | * [[RXN-15512]] | |
− | + | * [[RXN-17131]] | |
− | * [[RXN- | + | * [[RXN-17276]] |
− | * [[RXN- | ||
− | * [[ | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-15509]] | |
− | + | * [[RXN-15510]] | |
− | + | * [[RXN-15511]] | |
− | + | * [[RXN-15512]] | |
− | + | * [[RXN-17274]] | |
− | |||
− | |||
− | * [[RXN- | ||
− | * [[RXN- | ||
− | * [[RXN- | ||
− | * [[RXN- | ||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=& | + | {{#set: common-name=a [protein]-nπ-phospho-l-histidine}} |
− | |||
− |
Revision as of 14:56, 5 January 2021
Contents
Metabolite Protein-pi-phospho-L-histidines
- common-name:
- a [protein]-nπ-phospho-l-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-nπ-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.