Difference between revisions of "CPD-11241"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** h...")
(Created page with "Category:metabolite == Metabolite Protein-pi-phospho-L-histidines == * common-name: ** a [protein]-nπ-phospho-l-histidine == Reaction(s) known to consume the compound =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLC-1-P ==
+
== Metabolite Protein-pi-phospho-L-histidines ==
 
* common-name:
 
* common-name:
** α-d-glucopyranose 1-phosphate
+
** a [protein]-nπ-phospho-l-histidine
* smiles:
 
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
* inchi-key:
 
** hxxfsfrbohsimq-vfuothlcsa-l
 
* molecular-weight:
 
** 258.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[RXN-15509]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[RXN-15510]]
* [[PGCM]]
+
* [[RXN-15511]]
* [[PGMTh]]
+
* [[RXN-15512]]
* [[PHOSPHOGLUCMUT-RXN]]
+
* [[RXN-17131]]
* [[RXN-12486]]
+
* [[RXN-17276]]
* [[RXN-16997]]
 
* [[RXN4FS-13]]
 
* [[UG1PUT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[RXN-15509]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[RXN-15510]]
* [[GLYCOPHOSPHORYL-RXN]]
+
* [[RXN-15511]]
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[RXN-15512]]
* [[PGCM]]
+
* [[RXN-17274]]
* [[PGMTh]]
 
* [[PHOSPHOGLUCMUT-RXN]]
 
* [[RXN-12171]]
 
* [[RXN-12392]]
 
* [[RXN-12486]]
 
* [[RXN-14284]]
 
* [[RXN-14285]]
 
* [[RXN-14286]]
 
* [[RXN-14353]]
 
* [[RXN-1826]]
 
* [[RXN-9025]]
 
* [[RXN0-5182]]
 
* [[RXN0-5184]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
+
{{#set: common-name=a [protein]-nπ-phospho-l-histidine}}
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Revision as of 14:56, 5 January 2021

Metabolite Protein-pi-phospho-L-histidines

  • common-name:
    • a [protein]-nπ-phospho-l-histidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-nπ-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.