Difference between revisions of "N-acyl-sphingosylphosphorylcholine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18379 == * common-name: ** 1-myristoylglycerol 3-phosphate * smiles: ** cccccccccccccc(=o)occ(o)cop(=o)([o-])[o-] * inchi-key: ** faz...") |
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MALTOPENTAOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** maltopentaose |
* smiles: | * smiles: | ||
− | ** | + | ** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ftnipwxxignqqf-hzwihctqsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 828.725 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14281]] |
− | * [[RXN- | + | * [[RXN-14284]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14282]] |
+ | * [[RXN-14285]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=maltopentaose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=828.725}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite MALTOPENTAOSE
- common-name:
- maltopentaose
- smiles:
- c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
- inchi-key:
- ftnipwxxignqqf-hzwihctqsa-n
- molecular-weight:
- 828.725