Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-148 == * common-name: ** n-octane * smiles: ** cccccccc * inchi-key: ** tvmxdcgiabbofy-uhfffaoysa-n * molecular-weight: ** 114.23 ==...") |
(Created page with "Category:metabolite == Metabolite CPD-14736 == * common-name: ** l-kynurenine * smiles: ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) * inchi-key: ** ygpsjzoedvaxab-qmmmgpob...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14736 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-kynurenine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ygpsjzoedvaxab-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 208.216 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.6.1.7-RXN]] |
| + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.6.1.7-RXN]] | ||
| + | * [[ARYLFORMAMIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-kynurenine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ygpsjzoedvaxab-qmmmgpobsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=208.216}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-14736
- common-name:
- l-kynurenine
- smiles:
- c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1)
- inchi-key:
- ygpsjzoedvaxab-qmmmgpobsa-n
- molecular-weight:
- 208.216
