Difference between revisions of "Saturated-Fatty-Acyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15839 == * common-name: ** δ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c * inchi-key: ** o...") |
(Created page with "Category:metabolite == Metabolite ACETAMIDE == * common-name: ** acetamide * smiles: ** cc(=o)n * inchi-key: ** dlfvbjfmpxgrib-uhfffaoysa-n * molecular-weight: ** 59.068 =...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ACETAMIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** acetamide |
* smiles: | * smiles: | ||
| − | ** cc(= | + | ** cc(=o)n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dlfvbjfmpxgrib-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 59.068 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14728]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=acetamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dlfvbjfmpxgrib-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=59.068}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite ACETAMIDE
- common-name:
- acetamide
- smiles:
- cc(=o)n
- inchi-key:
- dlfvbjfmpxgrib-uhfffaoysa-n
- molecular-weight:
- 59.068
