Difference between revisions of "CPD-18076"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...") |
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LEUCOPELARGONIDIN-CMPD == |
* common-name: | * common-name: | ||
− | ** | + | ** (2r,3s,4s)-leucopelargonidin |
* smiles: | * smiles: | ||
− | ** c( | + | ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fsvmlwolzhgcqx-souvjxgzsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 290.272 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2r,3s,4s)-leucopelargonidin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fsvmlwolzhgcqx-souvjxgzsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=290.272}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite LEUCOPELARGONIDIN-CMPD
- common-name:
- (2r,3s,4s)-leucopelargonidin
- smiles:
- c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
- inchi-key:
- fsvmlwolzhgcqx-souvjxgzsa-n
- molecular-weight:
- 290.272